Benzoicacid, 2-amino-4-arsonoyl structure
|
Common Name | Benzoicacid, 2-amino-4-arsonoyl | ||
|---|---|---|---|---|
| CAS Number | 6295-18-7 | Molecular Weight | 261.06400 | |
| Density | N/A | Boiling Point | 636.8ºC at 760mmHg | |
| Molecular Formula | C7H8AsNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.9ºC | |
| Name | 2-amino-4-arsono-benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 636.8ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H8AsNO5 |
| Molecular Weight | 261.06400 |
| Flash Point | 338.9ºC |
| Exact Mass | 260.96200 |
| PSA | 120.85000 |
| InChIKey | FONAQXOHXLIQHK-UHFFFAOYSA-N |
| SMILES | Nc1cc([As](=O)(O)O)ccc1C(=O)O |
|
~%
Benzoicacid, 2-... CAS#:6295-18-7 |
| Literature: Doak; Steinman; Eagle Journal of the American Chemical Society, 1945 , vol. 67, p. 719 |
|
~%
Benzoicacid, 2-... CAS#:6295-18-7 |
| Literature: Gillieson; Kermack; Spragg Journal of the Chemical Society, 1935 , p. 470 |
| 4-Arsono-anthranilsaeure |
| 3-Amino-4-carboxy-phenylarsonsaeure |
| 2-amino-4-arsenoso-benzoic acid |
| 2-Amino-4-arsenoso-benzoesaeure |
| 2-Amino-4-arsono-benzoesaeure |
| 2-Amino-benzoesaeure-arsonsaeure-(4) |
| BENZOIC ACID,2-AMINO-4-ARSENOSO |