3-amino-8-phenyl-2,4,7,8,9-pentazabicyclo[4.3.0]nona-1,3,6-trien-5-one structure
|
Common Name | 3-amino-8-phenyl-2,4,7,8,9-pentazabicyclo[4.3.0]nona-1,3,6-trien-5-one | ||
|---|---|---|---|---|
| CAS Number | 6295-27-8 | Molecular Weight | 228.21000 | |
| Density | 1.73g/cm3 | Boiling Point | 376.8ºC at 760 mmHg | |
| Molecular Formula | C10H8N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | 5-amino-2-phenyl-3H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 376.8ºC at 760 mmHg |
| Molecular Formula | C10H8N6O |
| Molecular Weight | 228.21000 |
| Flash Point | 181.7ºC |
| Exact Mass | 228.07600 |
| PSA | 102.48000 |
| LogP | 0.66720 |
| Index of Refraction | 1.871 |
| InChIKey | OIAXNBVLMBXWJU-UHFFFAOYSA-N |
| SMILES | Nc1nc2nn(-c3ccccc3)nc2c(=O)[nH]1 |
|
~%
3-amino-8-pheny... CAS#:6295-27-8 |
| Literature: Benson et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 1816 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HMS2886D12 |
| 5-amino-2-phenyl-2,3-dihydro-7h-[1,2,3]triazolo[4,5-d]pyrimidin-7-one |
| 5-amino-2-phenyl-2,6-dihydro-[1,2,3]triazolo[4,5-d]pyrimidin-7-one |