(4-dimethylamino-2-methyl-5-propan-2-yl-phenyl) N-methylcarbamate structure
|
Common Name | (4-dimethylamino-2-methyl-5-propan-2-yl-phenyl) N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 6295-43-8 | Molecular Weight | 250.33700 | |
| Density | 1.042g/cm3 | Boiling Point | 355.1ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.6ºC | |
| Name | [4-(dimethylamino)-2-methyl-5-propan-2-ylphenyl] N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 355.1ºC at 760 mmHg |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.33700 |
| Flash Point | 168.6ºC |
| Exact Mass | 250.16800 |
| PSA | 41.57000 |
| LogP | 3.29350 |
| Index of Refraction | 1.532 |
| InChIKey | REYDBPVFUMFCHU-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C(C)C)c(N(C)C)cc1C |
|
~%
(4-dimethylamin... CAS#:6295-43-8 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 Full Text Show Details Stevens; Beutel Journal of the American Chemical Society, 1941 , vol. 63, p. 308,309 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Methyl-4-(dimethylamino)-5-isopropylphenyl-N-methyl-carbamat |
| 5-Dimethylamino-2-methylcarbamoyloxy-p-cymol |
| 4-(dimethylamino)-2-methyl-5-(propan-2-yl)phenyl methylcarbamate |
| methyl-carbamic acid-(4-dimethylamino-5-isopropyl-2-methyl-phenyl ester) |
| Methyl-carbamidsaeure-(4-dimethylamino-5-isopropyl-2-methyl-phenylester) |