2(3H)-Furanone,5-(4-chlorophenyl)-3-(phenylmethylene)- structure
|
Common Name | 2(3H)-Furanone,5-(4-chlorophenyl)-3-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 6295-78-9 | Molecular Weight | 282.72100 | |
| Density | 1.336g/cm3 | Boiling Point | 493.6ºC at 760mmHg | |
| Molecular Formula | C17H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.8ºC | |
| Name | (Z)-3-benzylidene-5-(4-chlorophenyl)furan-2(3H)-one |
|---|
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 493.6ºC at 760mmHg |
| Molecular Formula | C17H11ClO2 |
| Molecular Weight | 282.72100 |
| Flash Point | 276.8ºC |
| Exact Mass | 282.04500 |
| PSA | 26.30000 |
| LogP | 4.32130 |
| Index of Refraction | 1.678 |
| InChIKey | MXEGDHFMUSGPKT-UVTDQMKNSA-N |
| SMILES | O=C1OC(c2ccc(Cl)cc2)=CC1=Cc1ccccc1 |
|
~52%
2(3H)-Furanone,... CAS#:6295-78-9 |
| Literature: Alam; Husain, Asif; Hasan; Suruchi; Anwer European Journal of Medicinal Chemistry, 2009 , vol. 44, # 6 p. 2636 - 2642 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |