Benzenebutanoic acid, 4-[ (2-chloroethyl)ethylamino]- structure
|
Common Name | Benzenebutanoic acid, 4-[ (2-chloroethyl)ethylamino]- | ||
|---|---|---|---|---|
| CAS Number | 6296-43-1 | Molecular Weight | 269.76700 | |
| Density | 1.161g/cm3 | Boiling Point | 422.5ºC at 760 mmHg | |
| Molecular Formula | C14H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | 2-Phenyl-4-p--benzyliden-oxazolon-(5) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 422.5ºC at 760 mmHg |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.76700 |
| Flash Point | 209.3ºC |
| Exact Mass | 269.11800 |
| PSA | 40.54000 |
| LogP | 3.15900 |
| Index of Refraction | 1.559 |
| InChIKey | HYPAPTLGLZWLID-UHFFFAOYSA-N |
| SMILES | CCN(CCCl)c1ccc(CCCC(=O)O)cc1 |
|
~89%
Benzenebutanoic... CAS#:6296-43-1 |
| Literature: Gourdie; Prakash; Wakelin; Woodgate; Denny Journal of Medicinal Chemistry, 1991 , vol. 34, # 1 p. 240 - 248 |
|
~%
Benzenebutanoic... CAS#:6296-43-1 |
| Literature: Gourdie; Prakash; Wakelin; Woodgate; Denny Journal of Medicinal Chemistry, 1991 , vol. 34, # 1 p. 240 - 248 |
|
~%
Benzenebutanoic... CAS#:6296-43-1 |
| Literature: Gourdie; Prakash; Wakelin; Woodgate; Denny Journal of Medicinal Chemistry, 1991 , vol. 34, # 1 p. 240 - 248 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-{4-[bis-(2-chloro-ethyl)-amino]-benzylidene}-2-phenyl-4H-oxazol-5-one |
| 4-(4-(BIS-(2-CHLOROETHYL)AMINO)BENZYLIDENE-2-PHENYL-OXAZOLINE-5-ONE |
| 2-Phenyl-4-<4-(bis-(2-chlorethyl)-amino)-benzyliden>-oxazolinon-(5) |
| 4-<4-<Ethyl-(2-chlor-ethyl)-amino>-phenyl>-buttersaeure |
| 4-<4-<(2-chloroethyl)ethylamino>phenyl>butanoic acid |