[2,3-dichloro-4-(4-chlorobenzoyl)phenoxy]acetic acid structure
|
Common Name | [2,3-dichloro-4-(4-chlorobenzoyl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 62967-01-5 | Molecular Weight | 359.58900 | |
| Density | 1.507g/cm3 | Boiling Point | 547.8ºC at 760 mmHg | |
| Molecular Formula | C15H9Cl3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.1ºC | |
| Name | 2-[2,3-dichloro-4-(4-chlorobenzoyl)phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 547.8ºC at 760 mmHg |
| Molecular Formula | C15H9Cl3O4 |
| Molecular Weight | 359.58900 |
| Flash Point | 285.1ºC |
| Exact Mass | 357.95700 |
| PSA | 63.60000 |
| LogP | 4.34120 |
| Index of Refraction | 1.618 |
| InChIKey | NWMCYHHRDSLUGY-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(C(=O)c2ccc(Cl)cc2)c(Cl)c1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 263-773-5 |
| 4-(4-chlorobenzoyl)-2,3-dichlorophenoxy acetic acid |
| [2,3-dichloro-4-(4-chlorobenzoyl)phenoxy]acetic acid |