p-(p-Nitroanilino)phenyl isocyanate structure
|
Common Name | p-(p-Nitroanilino)phenyl isocyanate | ||
|---|---|---|---|---|
| CAS Number | 62967-27-5 | Molecular Weight | 255.22900 | |
| Density | 1.29g/cm3 | Boiling Point | 427.4ºC at 760 mmHg | |
| Molecular Formula | C13H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | 4-isocyanato-N-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760 mmHg |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.22900 |
| Flash Point | 212.3ºC |
| Exact Mass | 255.06400 |
| PSA | 87.28000 |
| LogP | 3.90190 |
| Index of Refraction | 1.628 |
| InChIKey | QSGQZDCTAJVFHA-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccc(Nc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
p-(p-Nitroanili... CAS#:62967-27-5 |
| Literature: Anjaneyulu B. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, p. 657 - 661 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ISOCYANIC ACID,(p-(p-NITROANILINO)PHENYL) |
| 4-Isocyano-4'-nitrodiphenylamine |
| 4-Nitro-4-isocyanatodiphenylamine |
| 4-Isocyanato-N-(4-nitrophenyl)benzenamine |
| N-(4-ISOCYANATOPHENYL)-4-NITRO-ANILINE |
| (p-(p-Nitroanilino)phenyl)isocyanic acid |