3,6-ditert-butyl-1H-pyridin-2-one structure
|
Common Name | 3,6-ditert-butyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 62969-81-7 | Molecular Weight | 207.31200 | |
| Density | 0.968g/cm3 | Boiling Point | 342.9ºC at 760 mmHg | |
| Molecular Formula | C13H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4ºC | |
| Name | 3,6-ditert-butyl-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.968g/cm3 |
|---|---|
| Boiling Point | 342.9ºC at 760 mmHg |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.31200 |
| Flash Point | 206.4ºC |
| Exact Mass | 207.16200 |
| PSA | 32.86000 |
| LogP | 2.96990 |
| Index of Refraction | 1.492 |
| InChIKey | NTVRDTDEUIKNNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(=O)[nH]1 |
|
~%
3,6-ditert-buty... CAS#:62969-81-7 |
| Literature: Overman,L.E.; Tsuboi,S.; Ross,J.P. Journal of the American Chemical Society, 1980 , vol. 102, p. 747 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,6-Di-tert-butyl-2-pyridon |
| 3,6-di-tert-butyl-1H-pyridin-2-one |