4-Pentenoic acid,2,4,5-tris(benzoylamino)-, methyl ester structure
|
Common Name | 4-Pentenoic acid,2,4,5-tris(benzoylamino)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6298-09-5 | Molecular Weight | 471.50500 | |
| Density | 1.243g/cm3 | Boiling Point | 815.3ºC at 760 mmHg | |
| Molecular Formula | C27H25N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 446.9ºC | |
| Name | methyl 2,4,5-tribenzamidopent-4-enoate |
|---|
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 815.3ºC at 760 mmHg |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.50500 |
| Flash Point | 446.9ºC |
| Exact Mass | 471.17900 |
| PSA | 113.60000 |
| LogP | 4.22220 |
| Index of Refraction | 1.607 |
| InChIKey | AACGMMSOMRBWNU-PYCFMQQDSA-N |
| SMILES | COC(=O)C(CC(=CNC(=O)c1ccccc1)NC(=O)c1ccccc1)NC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |