Androst-4-ene-3,11-dione,17-(1-oxopropoxy)-, (17b)- (9CI) structure
|
Common Name | Androst-4-ene-3,11-dione,17-(1-oxopropoxy)-, (17b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6298-21-1 | Molecular Weight | 358.47100 | |
| Density | 1.16g/cm3 | Boiling Point | 492.3ºC at 760mmHg | |
| Molecular Formula | C22H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | [(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3,11-dioxo-2,6,7,8,9,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760mmHg |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.47100 |
| Flash Point | 213.8ºC |
| Exact Mass | 358.21400 |
| PSA | 60.44000 |
| LogP | 4.01910 |
| Index of Refraction | 1.545 |
| InChIKey | HHOPZZNLTLSBAF-LBYDKSIMSA-N |
| SMILES | CCC(=O)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3C(=O)CC12C |
|
~%
Androst-4-ene-3... CAS#:6298-21-1 |
| Literature: Herr; Heyl Journal of the American Chemical Society, 1953 , vol. 75, p. 5927,5929 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 17-propionate |
| methyl-acetate |
| 3-n-propanoate |