3-(2,5-dichlorophenyl)-1-(2-furylmethyl)urea
Modify Date: 2025-09-20 12:20:13
3-(2,5-dichlorophenyl)-1-(2-furylmethyl)urea structure
|
Common Name | 3-(2,5-dichlorophenyl)-1-(2-furylmethyl)urea | ||
|---|---|---|---|---|
| CAS Number | 6298-29-9 | Molecular Weight | 285.12600 | |
| Density | 1.434g/cm3 | Boiling Point | 387.4ºC at 760 mmHg | |
| Molecular Formula | C12H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | 1-(2,5-dichlorophenyl)-3-(furan-2-ylmethyl)urea |
|---|
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 387.4ºC at 760 mmHg |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.12600 |
| Flash Point | 188.1ºC |
| Exact Mass | 284.01200 |
| PSA | 54.27000 |
| LogP | 4.37200 |
| Index of Refraction | 1.629 |
| InChIKey | LBJOSBILOPACNK-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccco1)Nc1cc(Cl)ccc1Cl |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |