Urea,N,N''-(methylenedi-4,1-phenylene)bis[N'-(2-furanylmethyl)- (9CI) structure
|
Common Name | Urea,N,N''-(methylenedi-4,1-phenylene)bis[N'-(2-furanylmethyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6298-31-3 | Molecular Weight | 444.48200 | |
| Density | 1.308g/cm3 | Boiling Point | 609.5ºC at 760mmHg | |
| Molecular Formula | C25H24N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.4ºC | |
| Name | 1-(furan-2-ylmethyl)-3-[4-[[4-(furan-2-ylmethylcarbamoylamino)phenyl]methyl]phenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 609.5ºC at 760mmHg |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.48200 |
| Flash Point | 322.4ºC |
| Exact Mass | 444.18000 |
| PSA | 108.54000 |
| LogP | 6.03460 |
| Index of Refraction | 1.656 |
| InChIKey | CNQOHTQEPNLYAH-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccco1)Nc1ccc(Cc2ccc(NC(=O)NCc3ccco3)cc2)cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| f0911-6212 |