Arsineoxide, hydroxy(o-nitrophenyl)(p-nitrophenyl)- (8CI) structure
|
Common Name | Arsineoxide, hydroxy(o-nitrophenyl)(p-nitrophenyl)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6299-14-5 | Molecular Weight | 352.13100 | |
| Density | N/A | Boiling Point | 599.4ºC at 760 mmHg | |
| Molecular Formula | C12H9AsN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.6ºC | |
| Name | (2-nitrophenyl)-(4-nitrophenyl)arsinic acid |
|---|
| Boiling Point | 599.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H9AsN2O6 |
| Molecular Weight | 352.13100 |
| Flash Point | 251.6ºC |
| Exact Mass | 351.96800 |
| PSA | 128.94000 |
| LogP | 1.52860 |
| InChIKey | AYOJGSCJCKCHRO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc([As](=O)(O)c2ccccc2[N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |