Benzamide,N-(1-nitro-2-naphthalenyl)-
Modify Date: 2025-09-18 17:56:17
Benzamide,N-(1-nitro-2-naphthalenyl)- structure
|
Common Name | Benzamide,N-(1-nitro-2-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6299-41-8 | Molecular Weight | 292.28900 | |
| Density | 1.364g/cm3 | Boiling Point | 403.2ºC at 760 mmHg | |
| Molecular Formula | C17H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | N-(1-nitronaphthalen-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 403.2ºC at 760 mmHg |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.28900 |
| Flash Point | 197.7ºC |
| Exact Mass | 292.08500 |
| PSA | 74.92000 |
| LogP | 4.59650 |
| Index of Refraction | 1.726 |
| InChIKey | LQKIJWZEGBTMHP-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc2ccccc2c1[N+](=O)[O-])c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,N-(1-... CAS#:6299-41-8 |
| Literature: Kelly; Day Journal of the American Chemical Society, 1945 , vol. 67, p. 1074 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Nitro-2-benzamidonaphthalin |
| 1-Nitro-2-benzamino-naphthalin |
| HMS3091K08 |