(5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester
(5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester structure
|
Common Name | (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 62995-58-8 | Molecular Weight | 309.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H15NO4 |
|---|---|
| Molecular Weight | 309.31600 |
| Exact Mass | 309.10000 |
| PSA | 68.39000 |
| LogP | 3.10260 |
| InChIKey | IBFQRCJXZZIXGG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)c1c[nH]c2ccc(OCc3ccccc3)cc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:41339-61-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 5-benzyloxyindol-3-ylglyoxylate |
| Methyl 2-[5-(benzyloxy)-1H-indol-3-yl]-2-oxoacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: The English name of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester. |
| Q: What is the molecular weight of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: Molecular weight of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is 309.31600. |
| Q: What is the LogP of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: LogP of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is 3.10260. |
| Q: What is the CAS number of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: CAS number of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is 62995-58-8. |
| Q: What is the polar surface area (PSA) of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: Polar surface area (PSA) of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is 68.39000. |
| Q: What are the downstream products of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: Related downstream products(CAS) of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester: 41339-61-1. |
| Q: What is the molecular formula of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: Molecular formula of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is C18H15NO4. |
| Q: What is the SMILES notation of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: SMILES notation of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is COC(=O)C(=O)c1c[nH]c2ccc(OCc3ccccc3)cc12. |
| Q: What English synonyms does (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester have? |
| A: English synonyms of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester: methyl 5-benzyloxyindol-3-ylglyoxylate, Methyl 2-[5-(benzyloxy)-1H-indol-3-yl]-2-oxoacetate. |
| Q: What is the InChIKey of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester? |
| A: InChIKey of (5-benzyloxy-1H-indol-3-yl)oxoacetic acid methyl ester is IBFQRCJXZZIXGG-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |