6β-Hydroxyandrost-4-ene-3,17-dione
Modify Date: 2025-09-07 12:06:39
6β-Hydroxyandrost-4-ene-3,17-dione structure
|
Common Name | 6β-Hydroxyandrost-4-ene-3,17-dione | ||
|---|---|---|---|---|
| CAS Number | 63-00-3 | Molecular Weight | 302.40800 | |
| Density | 1.19g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | 192-194 °C | |
| MSDS | N/A | Flash Point | 257.6ºC | |
| Name | 6β-hydroxyandrost-4-ene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Melting Point | 192-194 °C |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40800 |
| Flash Point | 257.6ºC |
| Exact Mass | 302.18800 |
| PSA | 54.37000 |
| LogP | 3.05820 |
| Index of Refraction | 1.569 |
| InChIKey | WVAMBAWFDOYFOD-DQXCSHPPSA-N |
| SMILES | CC12CCC3C(CC(O)C4=CC(=O)CCC43C)C1CCC2=O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2243-06-3|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]AD as substrate...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL5241253
|
|
Name: Inhibition of human placental microsome aromatase at 2 uM using [1beta3H]-androstened...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL4392014
|
|
Name: Inhibition of human placental microsome aromatase using [1beta3H]-androstenedione as ...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL4392015
|
|
Name: Inhibition of human placental microsome aromatase expressed in human MCF7 cells at 10...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL4392016
|
Total 4, Current Page 1 of 1
1
| 6beta-Hydroxyandrostenedione |
| 6alpha,17alpha-Dimethyltestosterone |
| 6beta-hydroxyandrost-4-ene-3,17-dione |
| 6|A,17|A-dimethyltestosterone |
| 6β-Hydroxy Androstenedione |