4-ANDROSTEN-16A-OL-3,17-DIONE structure
|
Common Name | 4-ANDROSTEN-16A-OL-3,17-DIONE | ||
|---|---|---|---|---|
| CAS Number | 63-02-5 | Molecular Weight | 302.40800 | |
| Density | 1.19g/cm3 | Boiling Point | 475.3ºC at 760 mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4ºC | |
| Name | 16α-hydroxyandrost-4-ene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 475.3ºC at 760 mmHg |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.40800 |
| Flash Point | 255.4ºC |
| Exact Mass | 302.18800 |
| PSA | 54.37000 |
| LogP | 3.05820 |
| Index of Refraction | 1.569 |
| InChIKey | SSBCZTXGVMMZOT-NBBHSKLNSA-N |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C)C1CC(O)C2=O |
|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]AD as substrate...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL5241253
|
| 16alpha-Hydroxyandrost-4-ene-3,17-dione |
| 16alpha-hydroxyandrost-4-ene-3,17-dione |
| (8R,9S,10R,13S,14S,16R)-16-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| 16|A-Hydroxyandrostenedione |
| 4-Androsten-16alpha-ol-3,17-dione |