16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal
Modify Date: 2026-06-28 18:13:32
16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal structure
|
Common Name | 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal | ||
|---|---|---|---|---|
| CAS Number | 630-43-3 | Molecular Weight | 432.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H36O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H36O6 |
|---|---|
| Molecular Weight | 432.5 |
| InChIKey | UCJFIFPQALSXQY-VEBXWIAYSA-N |
| SMILES | CC1CC2C(C(O)CC3(C)C2CC2OC(C)(C)OC23C(=O)CO)C2(C)CCC(=O)C=C12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 630-43-3? |
| A: Chinese name of 630-43-3 is 630-43-3. |
| Q: What is the molecular formula of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal? |
| A: Molecular formula of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal is C25H36O6. |
| Q: What is the CAS number of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal? |
| A: CAS number of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal is 630-43-3. |
| Q: What is the SMILES notation of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal? |
| A: SMILES notation of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal is CC1CC2C(C(O)CC3(C)C2CC2OC(C)(C)OC23C(=O)CO)C2(C)CCC(=O)C=C12. |
| Q: What is the molecular weight of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal? |
| A: Molecular weight of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal is 432.5. |
| Q: What is the InChIKey of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal? |
| A: InChIKey of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal is UCJFIFPQALSXQY-VEBXWIAYSA-N. |
| Q: What is the English name of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal? |
| A: The English name of 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal is 16alpha,17-Dihydroxy-6alpha-methylcorticosterone acetone ketal. |