1,10-Phenanthroline-5-carboxylic acid structure
|
Common Name | 1,10-Phenanthroline-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 630067-06-0 | Molecular Weight | 224.21500 | |
| Density | 1.431 | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 1,10-Phenanthroline-5-carboxylic acid |
|---|
| Density | 1.431 |
|---|---|
| Boiling Point | 467.2ºC at 760 mmHg |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.21500 |
| Flash Point | 236.3ºC |
| Exact Mass | 224.05900 |
| PSA | 63.08000 |
| LogP | 2.48120 |
| Index of Refraction | 1.769 |
| InChIKey | UCJSMIWAXWPDOJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cccnc2c2ncccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |