1-cyclohexyl-2,4-dioxo-pyrimidine-5-carbonitrile structure
|
Common Name | 1-cyclohexyl-2,4-dioxo-pyrimidine-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 6301-31-1 | Molecular Weight | 219.24000 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-cyclohexyl-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24000 |
| Exact Mass | 219.10100 |
| PSA | 78.65000 |
| LogP | 0.91348 |
| Index of Refraction | 1.58 |
| InChIKey | JLSXEXIHECOGFB-UHFFFAOYSA-N |
| SMILES | N#Cc1cn(C2CCCCC2)c(=O)[nH]c1=O |
| HS Code | 2933599090 |
|---|
|
~%
1-cyclohexyl-2,... CAS#:6301-31-1 |
| Literature: Atkinson et al. Journal of the Chemical Society, 1956 , p. 4118,4120 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Cyclohexyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidin-5-carbonitril |
| 5-Cyan-1-cyclohexyl-uracil |
| HMS1528O09 |
| 1-Cyclohexyl-1,2,3,4-tetrahydro-2,4-dioxopyrimidine-5-carbonitrile |
| 1-Cyclohexyl-5-Cyanouracil |
| 1-cyclohexyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |