2-(Ethylamino)-4,6-dimethyl[1,3]thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione structure
|
Common Name | 2-(Ethylamino)-4,6-dimethyl[1,3]thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione | ||
|---|---|---|---|---|
| CAS Number | 6301-65-1 | Molecular Weight | 240.28200 | |
| Density | 1.413g/cm3 | Boiling Point | 398.1ºC at 760 mmHg | |
| Molecular Formula | C9H12N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5ºC | |
| Name | 2-(ethylamino)-4,6-dimethyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
|---|
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 398.1ºC at 760 mmHg |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.28200 |
| Flash Point | 194.5ºC |
| Exact Mass | 240.06800 |
| PSA | 97.16000 |
| LogP | 0.19850 |
| Index of Refraction | 1.641 |
| InChIKey | VJTLGDOQLMJAIT-UHFFFAOYSA-N |
| SMILES | CCNc1nc2c(=O)n(C)c(=O)n(C)c2s1 |
|
~%
2-(Ethylamino)-... CAS#:6301-65-1 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
|
~%
2-(Ethylamino)-... CAS#:6301-65-1 |
| Literature: Blicke; Schaaf Journal of the American Chemical Society, 1956 , vol. 78, p. 5857,5860 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |