Methanediol,1-(1,3-benzodioxol-5-yl)-, 1,1-diacetate structure
|
Common Name | Methanediol,1-(1,3-benzodioxol-5-yl)-, 1,1-diacetate | ||
|---|---|---|---|---|
| CAS Number | 6301-72-0 | Molecular Weight | 252.22000 | |
| Density | 1.322g/cm3 | Boiling Point | 354.8ºC at 760 mmHg | |
| Molecular Formula | C12H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | [acetyloxy(1,3-benzodioxol-5-yl)methyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 354.8ºC at 760 mmHg |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22000 |
| Flash Point | 157.1ºC |
| Exact Mass | 252.06300 |
| PSA | 71.06000 |
| LogP | 1.54010 |
| Index of Refraction | 1.535 |
| InChIKey | KLVFTBKCHDAZFB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)c1ccc2c(c1)OCO2 |
|
~98%
Methanediol,1-(... CAS#:6301-72-0 |
| Literature: Jin, Tong-Shou; Du, Gui-Ying; Li, Tong-Shuang Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1998 , vol. 37, # 9 p. 939 - 940 |
|
~69%
Methanediol,1-(... CAS#:6301-72-0 |
| Literature: Jung, Misuk; Yoon, Jieun; Kim, Hak Sung; Ryu, Jae-Sang Synthesis, 2010 , # 16 art. no. F04310SS, p. 2713 - 2720 |
| 5-Diacetoxymethyl-benzo[1,3]dioxol |
| 1,3-benzodioxol-5-ylmethylene diacetate |
| 1,3-benzodioxol-5-ylmethanediyl diacetate |
| 5-diacetoxymethyl-benzo[1,3]dioxole |
| 1,1-diacetoxy-1-(3,4-methylenedioxyphenyl)methane |