ethyl 3-(3-chloro)anilino-2-butenoate structure
|
Common Name | ethyl 3-(3-chloro)anilino-2-butenoate | ||
|---|---|---|---|---|
| CAS Number | 63010-73-1 | Molecular Weight | 239.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(3-chloro)anilino-2-butenoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14ClNO2 |
|---|---|
| Molecular Weight | 239.69800 |
| Exact Mass | 239.07100 |
| PSA | 38.33000 |
| LogP | 3.29180 |
| InChIKey | FITNNHVLIQBMOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(C)Nc1cccc(Cl)c1 |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-(3-Chlor-anilino)-crotonsaeure-aethylester |
| 3-(3-chloro-anilino)-crotonic acid ethyl ester |
| 3-(3-Chlor-phenylimino)-buttersaeure-aethylester |