N-methyl-2,2-bis(methylsulfanyl)-N-phenyl-butanamide structure
|
Common Name | N-methyl-2,2-bis(methylsulfanyl)-N-phenyl-butanamide | ||
|---|---|---|---|---|
| CAS Number | 63017-92-5 | Molecular Weight | 269.42600 | |
| Density | 1.146g/cm3 | Boiling Point | 362.1ºC at 760 mmHg | |
| Molecular Formula | C13H19NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.8ºC | |
| Name | N-methyl-2,2-bis(methylsulfanyl)-N-phenylbutanamide |
|---|
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 362.1ºC at 760 mmHg |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.42600 |
| Flash Point | 172.8ºC |
| Exact Mass | 269.09100 |
| PSA | 70.91000 |
| LogP | 3.48170 |
| Index of Refraction | 1.593 |
| InChIKey | XULIPEBUGXWYKW-UHFFFAOYSA-N |
| SMILES | CCC(SC)(SC)C(=O)N(C)c1ccccc1 |
|
~%
N-methyl-2,2-bi... CAS#:63017-92-5 |
| Literature: Gassman,P.G.; Balchunis,R.J. Journal of Organic Chemistry, 1977 , vol. 42, p. 3236 - 3240 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |