α-acetamido-β-[1]benzothiophene-3-ylpropionic acid
![α-acetamido-β-[1]benzothiophene-3-ylpropionic acid Structure](https://image.chemsrc.com/caspic/248/63024-19-1.png)
α-acetamido-β-[1]benzothiophene-3-ylpropionic acid structure
|
Common Name | α-acetamido-β-[1]benzothiophene-3-ylpropionic acid | ||
|---|---|---|---|---|
| CAS Number | 63024-19-1 | Molecular Weight | 263.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | α-acetamido-β-[1]benzothiophene-3-ylpropionic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13NO3S |
|---|---|
| Molecular Weight | 263.31200 |
| Exact Mass | 263.06200 |
| PSA | 94.64000 |
| LogP | 2.42400 |
| InChIKey | CPRQXUYFBNCFQX-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1csc2ccccc12)C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:1956-23-6
CAS#:72120-71-9
CAS#:154902-51-9
CAS#:111139-55-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-acetyl-β-(3-benzo[b]thienyl)-DL-alanine |
| 2-Acetamino-3-benzo [b] thienyl-propionsaeure |
| (rac)-2-acetylamino-3-benzo[b]thiophen-3-yl-propionic acid |
| rac-2-acetamido-3-(benzo[b]thiophen-3-yl)propanoic acid |
| 2-acetylamino-3-benzo[b]thiophen-3-yl-propionic acid |
| 2-Acetamino-3-benzo [b] 3-thienyl-propionsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: The English name of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is α-acetamido-β-[1]benzothiophene-3-ylpropionic acid. |
| Q: What are the downstream products of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: Related downstream products(CAS) of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid: 1956-23-6;72120-71-9;154902-51-9;111139-55-0. |
| Q: What is the LogP of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: LogP of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is 2.42400. |
| Q: What is the CAS number of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: CAS number of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is 63024-19-1. |
| Q: What is the polar surface area (PSA) of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: Polar surface area (PSA) of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is 94.64000. |
| Q: What is the SMILES notation of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: SMILES notation of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is CC(=O)NC(Cc1csc2ccccc12)C(=O)O. |
| Q: What English synonyms does α-acetamido-β-[1]benzothiophene-3-ylpropionic acid have? |
| A: English synonyms of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid: N-acetyl-β-(3-benzo[b]thienyl)-DL-alanine, 2-Acetamino-3-benzo [b] thienyl-propionsaeure, (rac)-2-acetylamino-3-benzo[b]thiophen-3-yl-propionic acid, rac-2-acetamido-3-(benzo[b]thiophen-3-yl)propanoic acid, 2-acetylamino-3-benzo[b]thiophen-3-yl-propionic acid, 2-Acetamino-3-benzo [b] 3-thienyl-propionsaeure. |
| Q: What is the InChIKey of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: InChIKey of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is CPRQXUYFBNCFQX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 63024-19-1? |
| A: Chinese name of 63024-19-1 is 63024-19-1. |
| Q: What is the molecular formula of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid? |
| A: Molecular formula of α-acetamido-β-[1]benzothiophene-3-ylpropionic acid is C13H13NO3S. |