ethyl 4-oxo-2-phenyl-pentanoate structure
|
Common Name | ethyl 4-oxo-2-phenyl-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 6303-83-9 | Molecular Weight | 220.26400 | |
| Density | 1.068g/cm3 | Boiling Point | 318.5ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.6ºC | |
| Name | ethyl 4-oxo-2-phenylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 318.5ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 137.6ºC |
| Exact Mass | 220.11000 |
| PSA | 43.37000 |
| LogP | 2.31240 |
| Index of Refraction | 1.501 |
| InChIKey | MPTUXQOIIUTVGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(C)=O)c1ccccc1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Phenyl-4-oxo-valeriansaeure-aethylester |
| 2-Phenyl-laevulinsaeure-aethylester |
| 4-oxo-2-phenyl-valeric acid ethyl ester |
| 4-Oxo-2-phenyl-valeriansaeure-aethylester |