Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]
Modify Date: 2026-10-09 16:29:33
![Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] Structure](https://www.chemsrc.com/extcaspic/017/63033-35-2.png)
Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] structure
|
Common Name | Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] | ||
|---|---|---|---|---|
| CAS Number | 63033-35-2 | Molecular Weight | 360.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O5S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O5S3 |
|---|---|
| Molecular Weight | 360.4 |
| InChIKey | DCNUDLWURCVJEB-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(S(=O)(=O)c2ccc(S(N)(=O)=O)s2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]? |
| A: InChIKey of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] is DCNUDLWURCVJEB-UHFFFAOYSA-N. |
| Q: What is the English name of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]? |
| A: The English name of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] is Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]. |
| Q: What is the CAS number of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]? |
| A: CAS number of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] is 63033-35-2. |
| Q: What is the Chinese name of 63033-35-2? |
| A: Chinese name of 63033-35-2 is 63033-35-2. |
| Q: What is the SMILES notation of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]? |
| A: SMILES notation of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] is CC(=O)Nc1cccc(S(=O)(=O)c2ccc(S(N)(=O)=O)s2)c1. |
| Q: What is the molecular weight of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]? |
| A: Molecular weight of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] is 360.4. |
| Q: What is the molecular formula of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl]? |
| A: Molecular formula of Acetamide,n-[3-[[5-(aminosulfonyl)-2-thienyl]sulfonyl]phenyl] is C12H12N2O5S3. |