2,2,4,9,11, 11-Hexamethyldodecane structure
|
Common Name | 2,2,4,9,11, 11-Hexamethyldodecane | ||
|---|---|---|---|---|
| CAS Number | 6304-50-3 | Molecular Weight | 254.49400 | |
| Density | 0.779g/cm3 | Boiling Point | 285.1ºC at 760 mmHg | |
| Molecular Formula | C18H38 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.1ºC | |
| Name | 2,2,4,9,11,11-Hexamethyldodecane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.779g/cm3 |
|---|---|
| Boiling Point | 285.1ºC at 760 mmHg |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.49400 |
| Flash Point | 128.1ºC |
| Exact Mass | 254.29700 |
| LogP | 6.69140 |
| Index of Refraction | 1.435 |
| InChIKey | NJOPDRPUVCALJM-UHFFFAOYSA-N |
| SMILES | CC(CCCCC(C)CC(C)(C)C)CC(C)(C)C |
| HS Code | 2901100000 |
|---|
|
~%
2,2,4,9,11, 11-... CAS#:6304-50-3 |
| Literature: Kharasch et al. Journal of Organic Chemistry, 1954 , vol. 19, p. 1600,1605 Journal of Organic Chemistry, 1955 , vol. 20, p. 920,925 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2901100000 |
|---|---|
| Summary | 2901100000 saturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 2,4,9,11,11-Hexamethyldodecane |
| Dodecane,2,2,4,9,11,11-hexamethyl |
| 2,2,4,9,11,11-hexamethyl-dodecane |