dimethyl 2,3-dibenzoyloxybutanedioate structure
|
Common Name | dimethyl 2,3-dibenzoyloxybutanedioate | ||
|---|---|---|---|---|
| CAS Number | 6304-99-0 | Molecular Weight | 386.35200 | |
| Density | 1.288g/cm3 | Boiling Point | 518.7ºC at 760 mmHg | |
| Molecular Formula | C20H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | dimethyl 2,3-dibenzoyloxybutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 518.7ºC at 760 mmHg |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.35200 |
| Flash Point | 226.7ºC |
| Exact Mass | 386.10000 |
| PSA | 105.20000 |
| LogP | 1.78360 |
| Index of Refraction | 1.553 |
| InChIKey | KUXPBFJYMIIGBY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C(=O)OC |
|
~%
dimethyl 2,3-di... CAS#:6304-99-0 |
|
Literature: Pictet Jahresbericht ueber die Fortschritte der Chemie und Verwandter Theile Anderer Wissenschaften, 1882 , p. 855 Full Text Show Details Pictet Dissertation |
|
~%
dimethyl 2,3-di... CAS#:6304-99-0 |
| Literature: Frankland; Wharton Journal of the Chemical Society, 1896 , vol. 69, p. 1585 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| O,O'-Dibenzoyl-weinsaeure-dimethylester |
| dimethyl 2,3-bis(benzoyloxy)succinate |
| dimethyl 2,3-bis(benzoyloxy)butanedioate |
| Methyl-dibenzoyltartrat |
| O,O'-dibenzoyl-tartaric acid dimethyl ester |