Benzenamine, 4-[ (4-ethylphenyl)azo]- structure
|
Common Name | Benzenamine, 4-[ (4-ethylphenyl)azo]- | ||
|---|---|---|---|---|
| CAS Number | 63040-71-1 | Molecular Weight | 225.28900 | |
| Density | 1.09g/cm3 | Boiling Point | 394.5ºC at 760 mmHg | |
| Molecular Formula | C14H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | 4-[(4-ethylphenyl)diazenyl]aniline |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 394.5ºC at 760 mmHg |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.28900 |
| Flash Point | 192.4ºC |
| Exact Mass | 225.12700 |
| PSA | 50.74000 |
| LogP | 4.82780 |
| Index of Refraction | 1.591 |
| InChIKey | ILVYMULTJBGCNF-UHFFFAOYSA-N |
| SMILES | CCc1ccc(N=Nc2ccc(N)cc2)cc1 |
|
~%
Benzenamine, 4-... CAS#:63040-71-1 |
| Literature: Sharma, Manisha; Maheshwari, Arti; Bindal, Nitin Journal of Heterocyclic Chemistry, 2013 , vol. 50, # SUPPL.1 p. E116-E120 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |