6,8-dichloro-2-methyl-5H-purine structure
|
Common Name | 6,8-dichloro-2-methyl-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 6306-01-0 | Molecular Weight | 203.02900 | |
| Density | 1.86g/cm3 | Boiling Point | 286.5ºC at 760 mmHg | |
| Molecular Formula | C6H4Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.1ºC | |
| Name | 6,8-dichloro-2-methyl-7H-purine |
|---|
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 286.5ºC at 760 mmHg |
| Molecular Formula | C6H4Cl2N4 |
| Molecular Weight | 203.02900 |
| Flash Point | 127.1ºC |
| Exact Mass | 201.98100 |
| PSA | 54.46000 |
| LogP | 1.96810 |
| Index of Refraction | 1.797 |
| InChIKey | QZIGSPMPDANGLL-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c2[nH]c(Cl)nc2n1 |
|
~%
6,8-dichloro-2-... CAS#:6306-01-0 |
| Literature: Noell; Robins Journal of Organic Chemistry, 1959 , vol. 24, p. 320,321 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |