3-amino-5-ethylamino-9-thia-2,4,7-triazabicyclo[4.3.0]nona-1,3,5-triene-8-thione structure
|
Common Name | 3-amino-5-ethylamino-9-thia-2,4,7-triazabicyclo[4.3.0]nona-1,3,5-triene-8-thione | ||
|---|---|---|---|---|
| CAS Number | 6306-84-9 | Molecular Weight | 227.31000 | |
| Density | 1.58g/cm3 | Boiling Point | 530.6ºC at 760 mmHg | |
| Molecular Formula | C7H9N5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.7ºC | |
| Name | 5-amino-7-(ethylamino)-1H-[1,3]thiazolo[5,4-d]pyrimidine-2-thione |
|---|
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 530.6ºC at 760 mmHg |
| Molecular Formula | C7H9N5S2 |
| Molecular Weight | 227.31000 |
| Flash Point | 274.7ºC |
| Exact Mass | 227.03000 |
| PSA | 139.95000 |
| LogP | 2.41710 |
| Index of Refraction | 1.779 |
| InChIKey | UGRNSLDMBNPGAJ-UHFFFAOYSA-N |
| SMILES | CCNc1nc(N)nc2sc(=S)[nH]c12 |
|
~%
3-amino-5-ethyl... CAS#:6306-84-9 |
| Literature: Balsiger,R.W. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 3386 - 3388 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |