2-Naphthalenesulfonamide,N,N-diethyl- structure
|
Common Name | 2-Naphthalenesulfonamide,N,N-diethyl- | ||
|---|---|---|---|---|
| CAS Number | 6307-08-0 | Molecular Weight | 263.35500 | |
| Density | 1.185g/cm3 | Boiling Point | 411.5ºC at 760 mmHg | |
| Molecular Formula | C14H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | N,N-diethylnaphthalene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.185g/cm3 |
|---|---|
| Boiling Point | 411.5ºC at 760 mmHg |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.35500 |
| Flash Point | 202.6ºC |
| Exact Mass | 263.09800 |
| PSA | 45.76000 |
| LogP | 3.95110 |
| Index of Refraction | 1.595 |
| InChIKey | OLVARQRQEOOPHE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2ccccc2c1 |
|
~%
2-Naphthalenesu... CAS#:6307-08-0 |
| Literature: Campbell; Campbell; Salm Proceedings of the Indiana Academy of Science, 1947 , vol. 57, p. 100 Chem.Abstr., 1949 , p. 4630 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl-2-naphthalenesulfonamide |
| N,N-Diaethyl-naphthalin-2-sulfonamid |
| N,N-diethyl-naphthalene-2-sulfonamide |