Benzamide,N-2-naphthalenyl-2-nitro- structure
|
Common Name | Benzamide,N-2-naphthalenyl-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6307-09-1 | Molecular Weight | 292.28900 | |
| Density | 1.364g/cm3 | Boiling Point | 426.8ºC at 760 mmHg | |
| Molecular Formula | C17H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | N-naphthalen-2-yl-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 426.8ºC at 760 mmHg |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.28900 |
| Flash Point | 211.9ºC |
| Exact Mass | 292.08500 |
| PSA | 74.92000 |
| LogP | 4.59650 |
| Index of Refraction | 1.726 |
| InChIKey | ORAJHZFYEBEAGC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc2ccccc2c1)c1ccccc1[N+](=O)[O-] |
|
~%
Benzamide,N-2-n... CAS#:6307-09-1 |
| Literature: Hey; Turpin Journal of the Chemical Society, 1954 , p. 2471,2473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms3078f14 |