1,1,4,4-tetramethyltetralin-2-one structure
|
Common Name | 1,1,4,4-tetramethyltetralin-2-one | ||
|---|---|---|---|---|
| CAS Number | 6308-02-7 | Molecular Weight | 202.29200 | |
| Density | 0.965g/cm3 | Boiling Point | 293.6ºC at 760 mmHg | |
| Molecular Formula | C14H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.8ºC | |
| Name | 1,1,4,4-tetramethyl-3H-naphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 293.6ºC at 760 mmHg |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.29200 |
| Flash Point | 120.8ºC |
| Exact Mass | 202.13600 |
| PSA | 17.07000 |
| LogP | 3.21460 |
| Index of Refraction | 1.501 |
| InChIKey | PMQHKFROIUJQAE-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C(C)(C)c2ccccc21 |
|
~27%
1,1,4,4-tetrame... CAS#:6308-02-7 |
| Literature: Knorr, Rudolf; Menke, Thomas; Freudenreich, Johannes; Pires, Claudio Beilstein Journal of Organic Chemistry, 2014 , vol. 10, p. 307 - 315 |
|
~%
1,1,4,4-tetrame... CAS#:6308-02-7 |
| Literature: Barclay,L.R.C. et al. Canadian Journal of Chemistry, 1970 , vol. 48, p. 2764 - 2775 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 1,1,4,4-tetramethyl-2-tetralone |
| 1,1,4,4-Tetramethyl-2-tetralon-Radikal |
| 1,1,4,4-Tetramethyl-1,2,3,4-tetrahydronaphthalen-2-one |
| 1,1,4,4-tetramethyl-3,4-dihydro-1H-naphthalen-2-one |
| 1,1,4,4-tetramethylbenzcyclohexan-2-one |
| 1,1,4,4-Tetramethyl-3,4-dihydro-1H-naphthalin-2-on |