2-Pyrimidinamine,4-methyl-6-[[(4-nitrophenyl)methyl]thio]- structure
|
Common Name | 2-Pyrimidinamine,4-methyl-6-[[(4-nitrophenyl)methyl]thio]- | ||
|---|---|---|---|---|
| CAS Number | 6308-31-2 | Molecular Weight | 276.31400 | |
| Density | 1.39g/cm3 | Boiling Point | 537.7ºC at 760 mmHg | |
| Molecular Formula | C12H12N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279ºC | |
| Name | 4-methyl-6-[(4-nitrophenyl)methylsulfanyl]pyrimidin-2-amine |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 537.7ºC at 760 mmHg |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.31400 |
| Flash Point | 279ºC |
| Exact Mass | 276.06800 |
| PSA | 122.92000 |
| LogP | 3.67210 |
| Index of Refraction | 1.672 |
| InChIKey | UUJNHOPDGGNCPM-UHFFFAOYSA-N |
| SMILES | Cc1cc(SCc2ccc([N+](=O)[O-])cc2)nc(N)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |