1,4-Cyclohexanediol,1-benzoate structure
|
Common Name | 1,4-Cyclohexanediol,1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 6308-92-5 | Molecular Weight | 220.26400 | |
| Density | 1.16g/cm3 | Boiling Point | 346.1ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145ºC | |
| Name | (4-hydroxycyclohexyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 346.1ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 145ºC |
| Exact Mass | 220.11000 |
| PSA | 46.53000 |
| LogP | 2.14690 |
| Index of Refraction | 1.554 |
| InChIKey | LNXMWBSIGLFCEE-UHFFFAOYSA-N |
| SMILES | O=C(OC1CCC(O)CC1)c1ccccc1 |
| HS Code | 2916310090 |
|---|
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 4-hydroxycyclohexyl benzoate |
| 4-(phenylcarbonyloxy)cyclohexanol |
| 4-Benzoyloxycyclohexanol |
| ghl.PD_Mitscher_leg0.310 |
| Benzoesaeure-(4-hydroxycyclohexyl-ester) |