(5-chloro-2-methoxyphenyl)-(5-chloro-2-methoxyphenyl)imino-oxidoazanium structure
|
Common Name | (5-chloro-2-methoxyphenyl)-(5-chloro-2-methoxyphenyl)imino-oxidoazanium | ||
|---|---|---|---|---|
| CAS Number | 63083-96-5 | Molecular Weight | 327.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-chloro-2-methoxyphenyl)-(5-chloro-2-methoxyphenyl)imino-oxidoazanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12Cl2N2O3 |
|---|---|
| Molecular Weight | 327.16300 |
| Exact Mass | 326.02200 |
| PSA | 59.57000 |
| LogP | 5.45950 |
| InChIKey | SIVWVEOPMFWPFK-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1N=[N+]([O-])c1cc(Cl)ccc1OC |
|
~%
(5-chloro-2-met... CAS#:63083-96-5 |
| Literature: Raiford; Colbert Journal of the American Chemical Society, 1926 , vol. 48, p. 2654 |
|
~%
(5-chloro-2-met... CAS#:63083-96-5 |
| Literature: Raiford; Colbert Journal of the American Chemical Society, 1926 , vol. 48, p. 2654 |
|
~%
(5-chloro-2-met... CAS#:63083-96-5 |
| Literature: Gaudry; Keirstead Canadian Journal of Research, Section B: Chemical Sciences, 1949 , vol. 27, p. 897,899, 900 |
| 5.5'-Dichlor-2.2'-dimethoxy-azoxybenzol |
| Bis-(5-chlor-2-methoxy-phenyl)-diazen-N-oxid |
| bis-(5-chloro-2-methoxy-phenyl)-diazene-N-oxide |
| 2,2'-Dimethoxy-5,5'-dichlor-azoxybenzol |
| Diazene,bis(5-chloro-2-methoxyphenyl)-,1-oxide |