Arsinic acid, (4-hydroxy-3-nitrophenyl)(3-nitrophenyl)-(9CI) structure
|
Common Name | Arsinic acid, (4-hydroxy-3-nitrophenyl)(3-nitrophenyl)-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 6309-07-5 | Molecular Weight | 368.13100 | |
| Density | N/A | Boiling Point | 592.1ºC at 760mmHg | |
| Molecular Formula | C12H9AsN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.4ºC | |
| Name | (4-hydroxy-3-nitrophenyl)-(3-nitrophenyl)arsinic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 592.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H9AsN2O7 |
| Molecular Weight | 368.13100 |
| Flash Point | 247.4ºC |
| Exact Mass | 367.96300 |
| PSA | 149.17000 |
| LogP | 1.23420 |
| InChIKey | KUTSATQATMDZKA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([As](=O)(O)c2ccc(O)c([N+](=O)[O-])c2)c1 |
|
~%
Arsinic acid, (... CAS#:6309-07-5 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |
|
~%
Arsinic acid, (... CAS#:6309-07-5 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-Hydroxy-3-nitro-phenyl)-(3-nitro-phenyl)-arsinsaeure |
| (4-hydroxy-3-nitro-phenyl)-(3-nitro-phenyl)-arsinic acid |