(4-dibromoarsanylphenyl)-phenyl-methanone structure
|
Common Name | (4-dibromoarsanylphenyl)-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 6309-10-0 | Molecular Weight | 415.94000 | |
| Density | N/A | Boiling Point | 424.8ºC at 760 mmHg | |
| Molecular Formula | C13H9AsBr2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.2ºC | |
| Name | (4-dibromoarsanylphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 424.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H9AsBr2O |
| Molecular Weight | 415.94000 |
| Flash Point | 115.2ºC |
| Exact Mass | 413.82400 |
| PSA | 17.07000 |
| LogP | 3.40260 |
| InChIKey | YZWUJWVWDSNYKX-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc([As](Br)Br)cc1 |
|
~%
(4-dibromoarsan... CAS#:6309-10-0 |
| Literature: Blicke; Powers; Webster Journal of the American Chemical Society, 1932 , vol. 54, p. 2946 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Dibromarsino-benzophenon |
| 4-dibromoarsino-benzophenone |