Arsine sulfide,tris([1,1'-biphenyl]-4-yl)- structure
|
Common Name | Arsine sulfide,tris([1,1'-biphenyl]-4-yl)- | ||
|---|---|---|---|---|
| CAS Number | 6309-11-1 | Molecular Weight | 566.58600 | |
| Density | N/A | Boiling Point | 716ºC at 760 mmHg | |
| Molecular Formula | C36H27AsS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 386.8ºC | |
| Name | tris(4-phenylphenyl)-sulfanylidene-λ5-arsane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 716ºC at 760 mmHg |
|---|---|
| Molecular Formula | C36H27AsS |
| Molecular Weight | 566.58600 |
| Flash Point | 386.8ºC |
| Exact Mass | 566.10500 |
| PSA | 32.09000 |
| LogP | 7.85200 |
| InChIKey | PIAXUHBZBNABLG-UHFFFAOYSA-N |
| SMILES | S=[As](c1ccc(-c2ccccc2)cc1)(c1ccc(-c2ccccc2)cc1)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tris-biphenyl-4-yl-arsinsulfid |
| Tris-p-diphenylyl-arsinsulfid |
| tribiphenyl-4-ylarsane sulfide |
| tris-biphenyl-4-yl-arsine sulfide |