2-Hydroxy-2-naphthalen-1-yl-2-phenyl-acetic acid structure
|
Common Name | 2-Hydroxy-2-naphthalen-1-yl-2-phenyl-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6309-40-6 | Molecular Weight | 278.30200 | |
| Density | 1.309g/cm3 | Boiling Point | 500.2ºC at 760 mmHg | |
| Molecular Formula | C18H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.4ºC | |
| Name | 2-hydroxy-2-naphthalen-1-yl-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 500.2ºC at 760 mmHg |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.30200 |
| Flash Point | 270.4ºC |
| Exact Mass | 278.09400 |
| PSA | 57.53000 |
| LogP | 3.16030 |
| Index of Refraction | 1.684 |
| InChIKey | SCUTVJFQXIRWRF-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)(c1ccccc1)c1cccc2ccccc12 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-hydroxy-2-naphthalen-1-yl-2-phenyl-acetic acid |