2ξ-methyl-2ξ-(3-trimethylammonio-propyl)-(3ac,7ac)-1,3,3a,4,7,7a-hexahydro-4r,7c-methano-isoindolium, diiodide structure
|
Common Name | 2ξ-methyl-2ξ-(3-trimethylammonio-propyl)-(3ac,7ac)-1,3,3a,4,7,7a-hexahydro-4r,7c-methano-isoindolium, diiodide | ||
|---|---|---|---|---|
| CAS Number | 6309-69-9 | Molecular Weight | 377.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30IN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2ξ-methyl-2ξ-(3-trimethylammonio-propyl)-(3ac,7ac)-1,3,3a,4,7,7a-hexahydro-4r,7c-methano-isoindolium, diiodide |
|---|
| Molecular Formula | C16H30IN2+ |
|---|---|
| Molecular Weight | 377.32700 |
| Exact Mass | 377.14500 |
| InChIKey | PNNXHGSLCSQHIX-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCC[N+]1(C)CC2C3C=CC(C3)C2C1.[I-] |
|
~%
2ξ-methyl-2ξ-(3... CAS#:6309-69-9 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4911,4914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |