trimethyl-[3-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propyl]azanium structure
|
Common Name | trimethyl-[3-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propyl]azanium | ||
|---|---|---|---|---|
| CAS Number | 6309-75-7 | Molecular Weight | 367.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H32IN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[3-(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-ium-2-yl)propyl]azanium,iodide |
|---|
| Molecular Formula | C15H32IN2+ |
|---|---|
| Molecular Weight | 367.33200 |
| Exact Mass | 367.16100 |
| InChIKey | YYDWRQAHDROHPK-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCC[N+]1(C)CC2CCCCC2C1.[I-] |
|
~%
trimethyl-[3-(2... CAS#:6309-75-7 |
| Literature: Rice et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 4911,4914 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |