[heptan-2-yl(phenyl)phosphoryl]benzene structure
|
Common Name | [heptan-2-yl(phenyl)phosphoryl]benzene | ||
|---|---|---|---|---|
| CAS Number | 63103-37-7 | Molecular Weight | 300.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H25OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [heptan-2-yl(phenyl)phosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H25OP |
|---|---|
| Molecular Weight | 300.37500 |
| Exact Mass | 300.16400 |
| PSA | 26.88000 |
| LogP | 4.96930 |
| InChIKey | IIXVKZBXONMBPA-UHFFFAOYSA-N |
| SMILES | CCCCCC(C)P(=O)(c1ccccc1)c1ccccc1 |
|
~86%
[heptan-2-yl(ph... CAS#:63103-37-7 |
| Literature: Bertz, Steven H.; Dabbagh, Gary Journal of the American Chemical Society, 1981 , vol. 103, # 19 p. 5932 - 5934 |
|
~%
[heptan-2-yl(ph... CAS#:63103-37-7 |
| Literature: Davidson,A.H. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 550 - 565 |
| Phosphine oxide,(1-methylhexyl)diphenyl |
| (1-Methylhexyl)diphenylphosphinoxid |