naphtho[1,2-g]pteridine-9,11-diamine structure
|
Common Name | naphtho[1,2-g]pteridine-9,11-diamine | ||
|---|---|---|---|---|
| CAS Number | 63110-97-4 | Molecular Weight | 262.26900 | |
| Density | 1.549g/cm3 | Boiling Point | 663.7ºC at 760 mmHg | |
| Molecular Formula | C14H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.3ºC | |
| Name | naphtho[1,2-g]pteridine-9,11-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549g/cm3 |
|---|---|
| Boiling Point | 663.7ºC at 760 mmHg |
| Molecular Formula | C14H10N6 |
| Molecular Weight | 262.26900 |
| Flash Point | 393.3ºC |
| Exact Mass | 262.09700 |
| PSA | 103.60000 |
| LogP | 3.05300 |
| Index of Refraction | 1.931 |
| InChIKey | DHGUFUVSUAYZAH-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2nc3c(ccc4ccccc43)nc2n1 |
|
~%
naphtho[1,2-g]p... CAS#:63110-97-4 |
| Literature: Felton; Timmis Journal of the Chemical Society, 1954 , p. 2881,2885 |
|
~%
naphtho[1,2-g]p... CAS#:63110-97-4 |
| Literature: Felton; Timmis Journal of the Chemical Society, 1954 , p. 2881,2885 |
|
~%
naphtho[1,2-g]p... CAS#:63110-97-4 |
| Literature: Felton; Timmis Journal of the Chemical Society, 1954 , p. 2881,2885 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9,11-diaminonaphtho<1,2-g>pteridine |
| 9,10-Diaminonaphtho<1,2-g>pteridin |