1-Piperazineethanol, a-(4-chlorophenyl)-4-(phenylmethyl)-
Modify Date: 2025-09-09 23:30:52
1-Piperazineethanol, a-(4-chlorophenyl)-4-(phenylmethyl)- structure
|
Common Name | 1-Piperazineethanol, a-(4-chlorophenyl)-4-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6313-07-1 | Molecular Weight | 330.85200 | |
| Density | 1.201g/cm3 | Boiling Point | 475.3ºC at 760 mmHg | |
| Molecular Formula | C19H23ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.2ºC | |
| Name | 2-(4-benzylpiperazin-1-yl)-1-(4-chlorophenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 475.3ºC at 760 mmHg |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.85200 |
| Flash Point | 241.2ºC |
| Exact Mass | 330.15000 |
| PSA | 26.71000 |
| LogP | 3.06700 |
| Index of Refraction | 1.606 |
| InChIKey | XBIUJADNHMADBP-UHFFFAOYSA-N |
| SMILES | OC(CN1CCN(Cc2ccccc2)CC1)c1ccc(Cl)cc1 |
|
~92%
1-Piperazineeth... CAS#:6313-07-1 |
| Literature: Silhankova, Alexandra; Dobrovsky, Karel; Krejci, Ivan; Polivka, Zdenek Collection of Czechoslovak Chemical Communications, 1994 , vol. 59, # 3 p. 658 - 666 |
|
~%
1-Piperazineeth... CAS#:6313-07-1 |
| Literature: Silhankova, Alexandra; Dobrovsky, Karel; Krejci, Ivan; Polivka, Zdenek Collection of Czechoslovak Chemical Communications, 1994 , vol. 59, # 3 p. 658 - 666 |
|
~%
1-Piperazineeth... CAS#:6313-07-1 |
| Literature: Silhankova, Alexandra; Dobrovsky, Karel; Krejci, Ivan; Polivka, Zdenek Collection of Czechoslovak Chemical Communications, 1994 , vol. 59, # 3 p. 658 - 666 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(4-Benzyl-piperazino)-1-(4-chlor-phenyl)-aethanol |
| 2-(4-benzyl-piperazino)-1-(4-chloro-phenyl)-ethanol |
| 2-(4-benzylpiperazine-1-yl)-1-(4-chlorophenyl)ethanol |