Benzenebutanamide, a-butyl-N-ethyl- structure
|
Common Name | Benzenebutanamide, a-butyl-N-ethyl- | ||
|---|---|---|---|---|
| CAS Number | 6313-21-9 | Molecular Weight | 247.37600 | |
| Density | 0.949g/cm3 | Boiling Point | 409.5ºC at 760 mmHg | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.4ºC | |
| Name | N-ethyl-2-(2-phenylethyl)hexanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.949g/cm3 |
|---|---|
| Boiling Point | 409.5ºC at 760 mmHg |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.37600 |
| Flash Point | 250.4ºC |
| Exact Mass | 247.19400 |
| PSA | 29.10000 |
| LogP | 3.95260 |
| Index of Refraction | 1.498 |
| InChIKey | QMXLYLJNYOAODE-UHFFFAOYSA-N |
| SMILES | CCCCC(CCc1ccccc1)C(=O)NCC |
|
~%
Benzenebutanami... CAS#:6313-21-9 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-ethyl-2-phenethyl-hexanamide |
| 2-phenethyl-hexanoic acid ethylamide |
| 2-Phenaethyl-hexansaeure-aethylamid |