1,8-dihydroxy-4-[(4-methoxyphenyl)amino]-5-nitro-anthracene-9,10-dione structure
|
Common Name | 1,8-dihydroxy-4-[(4-methoxyphenyl)amino]-5-nitro-anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 63133-83-5 | Molecular Weight | 406.34500 | |
| Density | 1.576g/cm3 | Boiling Point | 647.5ºC at 760 mmHg | |
| Molecular Formula | C21H14N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.4ºC | |
| Name | 1,8-dihydroxy-4-(4-methoxyanilino)-5-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.576g/cm3 |
|---|---|
| Boiling Point | 647.5ºC at 760 mmHg |
| Molecular Formula | C21H14N2O7 |
| Molecular Weight | 406.34500 |
| Flash Point | 345.4ºC |
| Exact Mass | 406.08000 |
| PSA | 141.68000 |
| LogP | 4.12980 |
| Index of Refraction | 1.749 |
| InChIKey | YOUUGQXQJAKPTL-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(O)c3c2C(=O)c2c([N+](=O)[O-])ccc(O)c2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4-Anisidino)-1,8-dihydroxy-5-nitroanthraquinone |
| 9,10-Anthracenedione,1,8-dihydroxy-4-((4-methoxyphenyl)amino)-5-nitro |
| 1,8-DIHYDROXY-4-[(4-METHOXYPHENYL)AMINO]-5-NITRO-ANTHRACENE-9,10-DIONE |