diethyl beta,beta'-dihydroxybenzene-1,4-dipropionate structure
|
Common Name | diethyl beta,beta'-dihydroxybenzene-1,4-dipropionate | ||
|---|---|---|---|---|
| CAS Number | 63133-89-1 | Molecular Weight | 310.34200 | |
| Density | 1.204g/cm3 | Boiling Point | 458.6ºC at 760 mmHg | |
| Molecular Formula | C16H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | ethyl 3-[4-(3-ethoxy-1-hydroxy-3-oxopropyl)phenyl]-3-hydroxypropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 458.6ºC at 760 mmHg |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.34200 |
| Flash Point | 163ºC |
| Exact Mass | 310.14200 |
| PSA | 93.06000 |
| LogP | 1.65980 |
| Index of Refraction | 1.531 |
| InChIKey | YQKIPPOWPUMQJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(O)c1ccc(C(O)CC(=O)OCC)cc1 |
| HS Code | 2918199090 |
|---|
|
~87%
diethyl beta,be... CAS#:63133-89-1 |
| Literature: Chen, Xi'an; Zhang, Changfu; Wu, Huayue; Yu, Xiaochun; Su, Weike; Cheng, Jiang Synthesis, 2007 , # 20 p. 3233 - 3239 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| diethyl 3,3'-benzene-1,4-diylbis(3-hydroxypropanoate) |
| diethyl 3,3'-(1,4-phenylene)bis(3-hydroxypropanoate) |
| EINECS 263-900-4 |
| 1,4-benzenedipropanoic acid,|A,|A'-dihydroxy-,diethyl ester |